EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29NO13 |
| Net Charge | 0 |
| Average Mass | 575.523 |
| Monoisotopic Mass | 575.16389 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)C1=C(O)c2cc(C3OCC(O)C3O)nc2C(O)(C2OC(CO)C(O)C(O)C2O)C1=O |
| InChI | InChI=1S/C27H29NO13/c29-8-16-20(35)21(36)22(37)26(41-16)27(39)24-12(7-13(28-24)23-19(34)15(32)9-40-23)18(33)17(25(27)38)14(31)6-3-10-1-4-11(30)5-2-10/h1-7,15-16,19-23,26,28-30,32-37,39H,8-9H2/b6-3+ |
| InChIKey | DDYOBOBXPBUGTA-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cartormin (CHEBI:168612) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyoxolan-2-yl)-4,7-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1H-indol-6-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035209 | HMDB |
| 35013876 | ChemSpider |