EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H70O8 |
| Net Charge | 0 |
| Average Mass | 751.058 |
| Monoisotopic Mass | 750.50707 |
| SMILES | COc1cc(/C=C/C(=O)OCCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C46H70O8/c1-51-43-37-39(27-31-41(43)47)29-33-45(49)53-35-25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-36-54-46(50)34-30-40-28-32-42(48)44(38-40)52-2/h27-34,37-38,47-48H,3-26,35-36H2,1-2H3/b33-29+,34-30+ |
| InChIKey | CWBAUBYZOXBMBF-BNRZXNFUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,26-Hexacosanediol diferulate (CHEBI:168609) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 26-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyhexacosyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 30776850 | ChemSpider |
| HMDB0030751 | HMDB |