EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20N6O4 |
| Net Charge | 0 |
| Average Mass | 288.308 |
| Monoisotopic Mass | 288.15460 |
| SMILES | NC(=O)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C10H20N6O4/c11-5(2-1-3-15-10(13)14)8(18)16-6(9(19)20)4-7(12)17/h5-6H,1-4,11H2,(H2,12,17)(H,16,18)(H,19,20)(H4,13,14,15) |
| InChIKey | JSLGXODUIAFWCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arginyl-Asparagine (CHEBI:168583) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8076234 | ChemSpider |
| HMDB0028704 | HMDB |