EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O5 |
| Net Charge | 0 |
| Average Mass | 233.224 |
| Monoisotopic Mass | 233.10117 |
| SMILES | CC(O)C(N)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H15N3O5/c1-3(12)6(10)7(14)11-4(8(15)16)2-5(9)13/h3-4,6,12H,2,10H2,1H3,(H2,9,13)(H,11,14)(H,15,16) |
| InChIKey | UQTNIFUCMBFWEJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Threoninyl-Asparagine (CHEBI:168573) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 4-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16568387 | ChemSpider |
| HMDB0029056 | HMDB |