EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N3O4 |
| Net Charge | 0 |
| Average Mass | 219.241 |
| Monoisotopic Mass | 219.12191 |
| SMILES | NC(CCCNCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H17N3O4/c9-5(7(12)13)2-1-3-11-4-6(10)8(14)15/h5-6,11H,1-4,9-10H2,(H,12,13)(H,14,15) |
| InChIKey | BKYZUPUACXSQQT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DL-Ornithino-L-alanine (CHEBI:168570) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-5-[(2-amino-2-carboxyethyl)amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13508105 | ChemSpider |
| HMDB0029448 | HMDB |