EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29NO8 |
| Net Charge | 0 |
| Average Mass | 447.484 |
| Monoisotopic Mass | 447.18932 |
| SMILES | [H][C@@]12CCC(=O)[C@]3([H])Oc4c(OC5OC(CO)C(O)C(O)C5O)ccc5c4[C@]13CCN(C)[C@]2([H])C5 |
| InChI | InChI=1S/C23H29NO8/c1-24-7-6-23-11-3-4-13(26)21(23)32-20-14(5-2-10(16(20)23)8-12(11)24)30-22-19(29)18(28)17(27)15(9-25)31-22/h2,5,11-12,15,17-19,21-22,25,27-29H,3-4,6-9H2,1H3/t11-,12+,15?,17?,18?,19?,21-,22?,23-/m0/s1 |
| InChIKey | LAZTZBKWNKFJLP-FBSPHTLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydromorphone-3-glucoside (CHEBI:168552) is a morphinane alkaloid (CHEBI:25418) |
| IUPAC Name |
|---|
| (4R,4aR,7aR,12bS)-3-methyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinolin-7-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061144 | HMDB |