EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O6 |
| Net Charge | 0 |
| Average Mass | 256.254 |
| Monoisotopic Mass | 256.09469 |
| SMILES | COc1cc(C(O)CC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C12H16O6/c1-16-9-4-7(8(13)6-11(14)15)5-10(17-2)12(9)18-3/h4-5,8,13H,6H2,1-3H3,(H,14,15) |
| InChIKey | RNHAKYOYXCWNHW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-3-(3,4,5-trimethoxyphenyl)propanoic acid (CHEBI:168549) is a benzenes (CHEBI:22712) |
| 3-hydroxy-3-(3,4,5-trimethoxyphenyl)propanoic acid (CHEBI:168549) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-hydroxy-3-(3,4,5-trimethoxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 26728852 | ChemSpider |
| HMDB0141328 | HMDB |