EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O6S |
| Net Charge | 0 |
| Average Mass | 450.597 |
| Monoisotopic Mass | 450.20761 |
| SMILES | COCc1cccc(C[C@H](O)/C=C/[C@H]2[C@H](O)CC(=O)[C@@H]2CCSCCCC(=O)OC)c1 |
| InChI | InChI=1S/C24H34O6S/c1-29-16-18-6-3-5-17(13-18)14-19(25)8-9-20-21(23(27)15-22(20)26)10-12-31-11-4-7-24(28)30-2/h3,5-6,8-9,13,19-22,25-26H,4,7,10-12,14-16H2,1-2H3/b9-8+/t19-,20-,21-,22-/m1/s1 |
| InChIKey | FBQUXLIJKPWCAO-AZIFJQEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rivenprost (CHEBI:168543) has role anti-inflammatory agent (CHEBI:67079) |
| Rivenprost (CHEBI:168543) is a benzyl ether (CHEBI:59859) |
| IUPAC Name |
|---|
| methyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulanyl]butanoate |
| INN | Source |
|---|---|
| rivenprost | WHO MedNet |
| Synonyms | Source |
|---|---|
| (-)-ono-4819 | ChEMBL |
| ONO-4819 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:256382-08-8 | ChemIDplus |
| Citations |
|---|