EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N3O6 |
| Net Charge | 0 |
| Average Mass | 247.207 |
| Monoisotopic Mass | 247.08044 |
| SMILES | NC(=O)CC(N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13N3O6/c9-3(1-5(10)12)7(15)11-4(8(16)17)2-6(13)14/h3-4H,1-2,9H2,(H2,10,12)(H,11,15)(H,13,14)(H,16,17) |
| InChIKey | HZYFHQOWCFUSOV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asparaginyl-Aspartic acid (CHEBI:168535) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2,4-diamino-4-oxobutanoyl)amino]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 16568257 | ChemSpider |
| HMDB0028727 | HMDB |