EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40O4 |
| Net Charge | 0 |
| Average Mass | 380.569 |
| Monoisotopic Mass | 380.29266 |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C23H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)27-22(20-24)21-25/h3-4,6-7,9-10,22,24-25H,2,5,8,11-21H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | SLRKCKOWXHZSDR-PDBXOOCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MG(0:0/20:3(11Z,14Z,17Z)/0:0) (CHEBI:168524) is a endocannabinoid (CHEBI:67197) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl (11Z,14Z,17Z)-icosa-11,14,17-trienoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011545 | HMDB |
| 24765774 | ChemSpider |