EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H52O2 |
| Net Charge | 0 |
| Average Mass | 420.722 |
| Monoisotopic Mass | 420.39673 |
| SMILES | CCCCCC/C=C\CCCCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C28H52O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h7-8,19-20H,2-6,9-18,21-27H2,1H3,(H,29,30)/b8-7-,20-19- |
| InChIKey | YTXNXYICWVEHLL-BEKHICDCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 28:2(9Z,21Z) (CHEBI:168514) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (9Z,21Z)-octacosa-9,21-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030877 | LIPID MAPS |