EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19NO6 |
| Net Charge | 0 |
| Average Mass | 369.373 |
| Monoisotopic Mass | 369.12124 |
| SMILES | CN1CCc2cc3c(cc2C2OC(O)c4c(ccc5c4OCO5)C21)OCO3 |
| InChI | InChI=1S/C20H19NO6/c1-21-5-4-10-6-14-15(25-8-24-14)7-12(10)18-17(21)11-2-3-13-19(26-9-23-13)16(11)20(22)27-18/h2-3,6-7,17-18,20,22H,4-5,8-9H2,1H3 |
| InChIKey | XUYAYNRYVXHNOQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isorheagenine (CHEBI:168501) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 13-methyl-5,7,19,21,25-pentaoxa-13-azahexacyclo[12.11.0.02,10.04,8.015,23.018,22]pentacosa-2,4(8),9,15(23),16,18(22)-hexaen-24-ol |
| Manual Xrefs | Databases |
|---|---|
| 530117 | ChemSpider |
| HMDB0029360 | HMDB |