EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41F3O2 |
| Net Charge | 0 |
| Average Mass | 454.617 |
| Monoisotopic Mass | 454.30587 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(O)C(F)(F)F)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C27H41F3O2/c1-18-9-12-22(31)17-21(18)11-10-20-8-6-15-25(3)23(13-14-24(20)25)19(2)7-5-16-26(4,32)27(28,29)30/h10-11,19,22-24,31-32H,1,5-9,12-17H2,2-4H3/b20-10+,21-11-/t19-,22+,23-,24+,25-,26?/m1/s1 |
| InChIKey | WBWNQJTXNKZCBN-JJQCCTCBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26,26,26-trifluoro-25-hydroxyvitamin D3 / 26,26,26-trifluoro-25-hydroxycholecalciferol (CHEBI:168482) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-7,7,7-triluoro-6-hydroxy-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| Manual Xrefs | Databases |
|---|---|
| 7826316 | ChemSpider |
| LMST03020131 | LIPID MAPS |