EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38O8 |
| Net Charge | 0 |
| Average Mass | 526.626 |
| Monoisotopic Mass | 526.25667 |
| SMILES | [H][C@]12CC[C@]3(C)C([C@H](C)[C@@]4([H])CC(C)=C(C)C(=O)O4)=C[C@H](OC(C)=O)[C@@]3(O)[C@]1([H])C[C@@]1([H])O[C@]13[C@@H](O)C=CC(=O)[C@]23C |
| InChI | InChI=1S/C30H38O8/c1-14-11-21(37-26(34)15(14)2)16(3)19-12-24(36-17(4)31)29(35)20-13-25-30(38-25)23(33)8-7-22(32)28(30,6)18(20)9-10-27(19,29)5/h7-8,12,16,18,20-21,23-25,33,35H,9-11,13H2,1-6H3/t16-,18-,20+,21+,23-,24-,25+,27+,28-,29-,30+/m0/s1 |
| InChIKey | PLPXOWZTDPJPHC-ISIACCJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Withangulatin A (CHEBI:168477) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| [(1S,2R,6S,7R,9R,11R,12R,13S,16R)-15-[(1S)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-6,12-dihydroxy-2,16-dimethyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadeca-4,14-dien-13-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 130203 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:120824-03-5 | ChemIDplus |