EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O2 |
| Net Charge | 0 |
| Average Mass | 316.400 |
| Monoisotopic Mass | 316.14633 |
| SMILES | CCC#CCC#CCC#CCC#CCC#CCC#CCCC(=O)O |
| InChI | InChI=1S/C22H20O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2,5,8,11,14,17,20-21H2,1H3,(H,23,24) |
| InChIKey | OYADDSIRDBGZMY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,7,10,13,16,19-Docosahexaynoic acid (CHEBI:168458) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| docosa-4,7,10,13,16,19-hexaynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 7822542 | ChemSpider |
| LMFA01030677 | LIPID MAPS |