EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H37NO2 |
| Net Charge | 0 |
| Average Mass | 311.510 |
| Monoisotopic Mass | 311.28243 |
| SMILES | CCCCCCCCC/C(C)=C/CC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C19H37NO2/c1-3-4-5-6-7-8-10-13-17(2)14-11-9-12-15-19(22)18(20)16-21/h12,14-15,18-19,21-22H,3-11,13,16,20H2,1-2H3/b15-12+,17-14+/t18-,19+/m0/s1 |
| InChIKey | QCUHPIBMMDIRKL-JWBJMZHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4E,8E,9Me-d19:2)sphingosine (CHEBI:168456) is a amino alcohol (CHEBI:22478) |
| IUPAC Name |
|---|
| (2S,3R,4E,8E)-2-amino-9-methyloctadeca-4,8-diene-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| LMSP01080012 | LIPID MAPS |
| 9089212 | ChemSpider |