EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O4 |
| Net Charge | 0 |
| Average Mass | 228.203 |
| Monoisotopic Mass | 228.04226 |
| SMILES | O=c1oc2cc(O)ccc2c2ccc(O)cc12 |
| InChI | InChI=1S/C13H8O4/c14-7-1-3-9-10-4-2-8(15)6-12(10)17-13(16)11(9)5-7/h1-6,14-15H |
| InChIKey | RIUPLDUFZCXCHM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Urolithin A (CHEBI:168442) has role geroprotector (CHEBI:176497) |
| Urolithin A (CHEBI:168442) is a coumarins (CHEBI:23403) |
| Urolithin A (CHEBI:168442) is a urolithin (CHEBI:234554) |
| IUPAC Name |
|---|
| 3,8-dihydroxybenzo[c]chromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 4589709 | ChemSpider |
| DB15464 | DrugBank |
| HMDB0013695 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1143-70-0 | ChemIDplus |
| Citations |
|---|