EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20O13 |
| Net Charge | 0 |
| Average Mass | 504.400 |
| Monoisotopic Mass | 504.09039 |
| SMILES | COc1c(O)cc2c(=O)oc3c(OC4OC(C)C(O)C(O)C4OC(C)=O)c(O)cc4c(=O)oc1c2c34 |
| InChI | InChI=1S/C23H20O13/c1-6-14(27)15(28)20(33-7(2)24)23(32-6)36-17-11(26)5-9-13-12-8(22(30)35-19(13)17)4-10(25)16(31-3)18(12)34-21(9)29/h4-6,14-15,20,23,25-28H,1-3H3 |
| InChIKey | XOBMJVRDRZBSBR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methylellagic acid 8-(2-acetylrhamnoside) (CHEBI:168439) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| [2-[(6,13-dihydroxy-14-methoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037080 | HMDB |