EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O5 |
| Net Charge | 0 |
| Average Mass | 244.287 |
| Monoisotopic Mass | 244.13107 |
| SMILES | CC(C(=O)CCC(=O)O)C(O)CCCCC=O |
| InChI | InChI=1S/C12H20O5/c1-9(11(15)6-7-12(16)17)10(14)5-3-2-4-8-13/h8-10,14H,2-7H2,1H3,(H,16,17) |
| InChIKey | AZUZXOSWBOBCJY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Polyethylene, oxidized (CHEBI:168411) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 6-hydroxy-5-methyl-4,11-dioxoundecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0032472 | HMDB |
| 21258154 | ChemSpider |