EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21F3O5 |
| Net Charge | 0 |
| Average Mass | 374.355 |
| Monoisotopic Mass | 374.13411 |
| SMILES | [H][C@]1(c2ccccc2O)O[C@@H](C(F)(F)F)OC[C@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C18H21F3O5/c19-18(20,21)17-25-11-12(7-3-1-2-4-10-15(23)24)16(26-17)13-8-5-6-9-14(13)22/h1,3,5-6,8-9,12,16-17,22H,2,4,7,10-11H2,(H,23,24)/b3-1-/t12-,16+,17+/m1/s1 |
| InChIKey | ZWAVGFSZMACJHA-PMNBYGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-[2-Trifluoromethyl-4-(2-hydroxyphenyl)-1,3-dioxan-cis-5-yl]-hept-5z-enoic acid (CHEBI:168382) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (Z)-7-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(triluoromethyl)-1,3-dioxan-5-yl]hept-5-enoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:106393-80-0 | ChemIDplus |