EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O3 |
| Net Charge | 0 |
| Average Mass | 290.403 |
| Monoisotopic Mass | 290.18819 |
| SMILES | C/C=C\C=C\C#CC/C=C(\O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H26O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h2-5,14,19H,7,9-13,15-16H2,1H3,(H,20,21)/b3-2-,5-4+,17-14- |
| InChIKey | ZEUJRMMYGFFECR-XXSBLCDOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Athanacalvic acid (CHEBI:168365) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (9Z,14E,16Z)-9-hydroxyoctadeca-9,14,16-trien-12-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01031032 | LIPID MAPS |