EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O4 |
| Net Charge | 0 |
| Average Mass | 240.259 |
| Monoisotopic Mass | 240.11101 |
| SMILES | COc1cc(C[C@](C)(NN)C(=O)O)ccc1O |
| InChI | InChI=1S/C11H16N2O4/c1-11(13-12,10(15)16)6-7-3-4-8(14)9(5-7)17-2/h3-5,13-14H,6,12H2,1-2H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | CZEXQBQCMOVXGP-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-hydrazinyl-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoic acid (CHEBI:168327) is a benzenes (CHEBI:22712) |
| (2S)-2-hydrazinyl-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoic acid (CHEBI:168327) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-2-hydrazinyl-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8374147 | ChemSpider |
| HMDB0142637 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:84488-77-7 | ChemIDplus |