EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O2 |
| Net Charge | 0 |
| Average Mass | 154.209 |
| Monoisotopic Mass | 154.09938 |
| SMILES | CC[C@H](C)/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C9H14O2/c1-3-8(2)6-4-5-7-9(10)11/h4-8H,3H2,1-2H3,(H,10,11)/b6-4+,7-5+/t8-/m0/s1 |
| InChIKey | DNUJBTBPCOIYRL-QALPAXIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dendryphiellic acid A (CHEBI:168321) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6S)-6-methylocta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020398 | LIPID MAPS |
| 9063392 | ChemSpider |