EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O3 |
| Net Charge | 0 |
| Average Mass | 220.268 |
| Monoisotopic Mass | 220.10994 |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C13H16O3/c1-3-16-13(15)12(10(2)14)9-11-7-5-4-6-8-11/h4-8,12H,3,9H2,1-2H3 |
| InChIKey | XDWQYMXQMNUWID-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 2-benzylacetoacetate (CHEBI:168288) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| ethyl 2-benzyl-3-oxobutanoate |
| Manual Xrefs | Databases |
|---|---|
| 216124 | ChemSpider |
| HMDB0040424 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:620-79-1 | ChemIDplus |