EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22NO4 |
| Net Charge | +1 |
| Average Mass | 280.344 |
| Monoisotopic Mass | 280.15433 |
| SMILES | COc1cc(/C=C/C(=O)OCC[N+](C)(C)C)ccc1O |
| InChI | InChI=1S/C15H21NO4/c1-16(2,3)9-10-20-15(18)8-6-12-5-7-13(17)14(11-12)19-4/h5-8,11H,9-10H2,1-4H3/p+1 |
| InChIKey | XHSNXOZZHHJDDX-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Feruloylcholine (CHEBI:168277) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyethyl-trimethylazanium |
| Manual Xrefs | Databases |
|---|---|
| 30776954 | ChemSpider |
| HMDB0032800 | HMDB |