EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H24O20 |
| Net Charge | 0 |
| Average Mass | 728.524 |
| Monoisotopic Mass | 728.08609 |
| SMILES | O=C1OC(CO)C(O)C2OC(=O)c3c(c(O)c(O)c(O)c3C3C(O)C(=O)C45Oc6c(ccc(O)c6O)C4C2OC(=O)C35O)-c2c1cc(O)c(O)c2O |
| InChI | InChI=1S/C32H24O20/c33-4-9-18(38)26-25-14-5-1-2-7(34)17(37)24(5)52-32(14)27(44)22(42)15(31(32,48)30(47)51-25)13-12(29(46)50-26)11(20(40)23(43)21(13)41)10-6(28(45)49-9)3-8(35)16(36)19(10)39/h1-3,9,14-15,18,22,25-26,33-43,48H,4H2 |
| InChIKey | VZXYUZYVJJYUMH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4,7,8,9,15,22,23,28,33-undecahydroxy-14-(hydroxymethyl)-13,25,32,35-tetraoxaoctacyclo[14.13.3.3??,??.0?,??.0?,??.0??,??.0??,??.0??,??]pentatriaconta-1,3,5(30),6,8,10,19(24),20,22-nonaene-12,27,31,34-tetrone (CHEBI:168263) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 2,3,4,7,8,9,15,22,23,28,33-undecahydroxy-14-(hydroxymethyl)-13,25,32,35-tetraoxaoctacyclo[14.13.3.317,26.05,30.06,11.018,26.019,24.029,33]pentatriaconta-1,3,5(30),6,8,10,19(24),20,22-nonaene-12,27,31,34-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 74886808 | ChemSpider |
| HMDB0134701 | HMDB |