EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O9 |
| Net Charge | 0 |
| Average Mass | 352.295 |
| Monoisotopic Mass | 352.07943 |
| SMILES | O=C(/C=C\C1=CC(=O)C(=O)C=C1)OC1CC(O)(C(=O)O)CC(O)C1O |
| InChI | InChI=1S/C16H16O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,19,21,24H,6-7H2,(H,22,23)/b4-2- |
| InChIKey | ITENTBHADJNDDH-RQOWECAXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlorogenoquinone (CHEBI:168246) is a quinic acid (CHEBI:26493) |
| IUPAC Name |
|---|
| 3-[(Z)-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029383 | HMDB |
| 35032860 | ChemSpider |