EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31NO |
| Net Charge | 0 |
| Average Mass | 277.452 |
| Monoisotopic Mass | 277.24056 |
| SMILES | CC/C=C\C/C=C\C/C=C\CC/C=C/C[C@@H](O)[C@H](C)N |
| InChI | InChI=1S/C18H31NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(20)17(2)19/h4-5,7-8,10-11,14-15,17-18,20H,3,6,9,12-13,16,19H2,1-2H3/b5-4-,8-7-,11-10-,15-14+/t17-,18+/m0/s1 |
| InChIKey | PEVJDMWZXLRJSP-LFPPQAFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Crucigasterin 277 (CHEBI:168234) is a amino alcohol (CHEBI:22478) |
| IUPAC Name |
|---|
| (2S,3R,5E,9Z,12Z,15Z)-2-aminooctadeca-5,9,12,15-tetraen-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 24823227 | ChemSpider |
| LMSP01080036 | LIPID MAPS |