EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O6 |
| Net Charge | 0 |
| Average Mass | 276.244 |
| Monoisotopic Mass | 276.06339 |
| SMILES | C[C@H]1CC2=C(C(=O)c3c(O)cc(O)cc3C2=O)[C@H](O)O1 |
| InChI | InChI=1S/C14H12O6/c1-5-2-7-11(14(19)20-5)13(18)10-8(12(7)17)3-6(15)4-9(10)16/h3-5,14-16,19H,2H2,1H3/t5-,14+/m0/s1 |
| InChIKey | NNXPHSFVRRTOJM-OVZGEXIGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thysanone (CHEBI:168200) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (1R,3S)-1,7,9-trihydroxy-3-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| Manual Xrefs | Databases |
|---|---|
| LMPK13030001 | LIPID MAPS |
| 8509107 | ChemSpider |