EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O4 |
| Net Charge | 0 |
| Average Mass | 274.401 |
| Monoisotopic Mass | 274.21441 |
| SMILES | O=C(O)C(O)CCCCCCCCCCCCCO |
| InChI | InChI=1S/C15H30O4/c16-13-11-9-7-5-3-1-2-4-6-8-10-12-14(17)15(18)19/h14,16-17H,1-13H2,(H,18,19) |
| InChIKey | BYSNBUIZJVDCKG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,15-dihydroxy-pentadecylic acid (CHEBI:168166) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 2,15-dihydroxypentadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4446051 | ChemSpider |
| LMFA01050082 | LIPID MAPS |