EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H43NO |
| Net Charge | 0 |
| Average Mass | 313.570 |
| Monoisotopic Mass | 313.33446 |
| SMILES | CCC(C)CC(C)CCCCCCCCCCC(O)C(C)N |
| InChI | InChI=1S/C20H43NO/c1-5-17(2)16-18(3)14-12-10-8-6-7-9-11-13-15-20(22)19(4)21/h17-20,22H,5-16,21H2,1-4H3 |
| InChIKey | PRIXJBFEYXJGPF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-14,16-dimethyloctadecan-3-ol (CHEBI:168138) is a amino alcohol (CHEBI:22478) |
| IUPAC Name |
|---|
| 2-amino-14,16-dimethyloctadecan-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 8412115 | ChemSpider |
| LMSP01080031 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:540770-33-0 | ChemIDplus |