EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40O5 |
| Net Charge | 0 |
| Average Mass | 396.568 |
| Monoisotopic Mass | 396.28757 |
| SMILES | CCCCCC1C(O)CC(O)C1/C=C/C(O)C/C=C\CCCCCCC(=O)O |
| InChI | InChI=1S/C23H40O5/c1-2-3-9-13-19-20(22(26)17-21(19)25)16-15-18(24)12-10-7-5-4-6-8-11-14-23(27)28/h7,10,15-16,18-22,24-26H,2-6,8-9,11-14,17H2,1H3,(H,27,28)/b10-7-,16-15+ |
| InChIKey | DTTMKDYOUCSFNN-NTZQAAQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-F2-dihomo-IsoP (CHEBI:168118) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (8Z,12E)-13-(3,5-dihydroxy-2-pentylcyclopentyl)-11-hydroxytrideca-8,12-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA03110168 | LIPID MAPS |