EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H30O3 |
| Net Charge | 0 |
| Average Mass | 282.424 |
| Monoisotopic Mass | 282.21949 |
| SMILES | CCCCCC(O)/C=C/C=C/CCCCCCC(=O)O |
| InChI | InChI=1S/C17H30O3/c1-2-3-10-13-16(18)14-11-8-6-4-5-7-9-12-15-17(19)20/h6,8,11,14,16,18H,2-5,7,9-10,12-13,15H2,1H3,(H,19,20)/b8-6+,14-11+ |
| InChIKey | INVCGLRLLKLTGP-SIGMCMEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-hydroxy-8E,10E-heptadecadienoic acid (CHEBI:168099) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (8E,10E)-12-hydroxyheptadeca-8,10-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472189 | ChemSpider |
| LMFA01050194 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:15514-88-2 | ChemIDplus |