EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O14 |
| Net Charge | 0 |
| Average Mass | 504.441 |
| Monoisotopic Mass | 504.14791 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C21H28O14/c22-6-12-16(28)19(31)21(8-23,34-12)35-20-18(30)17(29)15(27)13(33-20)7-32-14(26)4-2-9-1-3-10(24)11(25)5-9/h1-5,12-13,15-20,22-25,27-31H,6-8H2/b4-2+ |
| InChIKey | UZUDNVXQOKQTDO-DUXPYHPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Caffeoylsucrose (CHEBI:168078) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [6-[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035486 | HMDB |