EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2 |
| Net Charge | 0 |
| Average Mass | 184.242 |
| Monoisotopic Mass | 184.10005 |
| SMILES | CC1=NCCc2c1nc1ccccc21 |
| InChI | InChI=1S/C12H12N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-5,14H,6-7H2,1H3 |
| InChIKey | CWOYLIJQLSNRRN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Harmalan (CHEBI:168077) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole |
| Manual Xrefs | Databases |
|---|---|
| 10309487 | ChemSpider |
| HMDB0029834 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:525-41-7 | ChemIDplus |