EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O7 |
| Net Charge | 0 |
| Average Mass | 518.691 |
| Monoisotopic Mass | 518.32435 |
| SMILES | CC(=O)OC1CC(O)CC2=CCC3C4CCC(C(C)(O)C(O)CC5COC(=O)C5C)C4(C)CCC3C21C |
| InChI | InChI=1S/C30H46O7/c1-16-18(15-36-27(16)34)12-25(33)30(5,35)24-9-8-22-21-7-6-19-13-20(32)14-26(37-17(2)31)29(19,4)23(21)10-11-28(22,24)3/h6,16,18,20-26,32-33,35H,7-15H2,1-5H3 |
| InChIKey | ODRFODNLKCBNIK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Perulactone (CHEBI:168071) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| [17-[2,3-dihydroxy-4-(4-methyl-5-oxooxolan-3-yl)butan-2-yl]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 383491 | ChemSpider |
| HMDB0034392 | HMDB |