EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O9 |
| Net Charge | 0 |
| Average Mass | 356.327 |
| Monoisotopic Mass | 356.11073 |
| SMILES | COc1cc(/C=C/C(=O)OCC2OC(O)C(O)C(O)C2O)ccc1O |
| InChI | InChI=1S/C16H20O9/c1-23-10-6-8(2-4-9(10)17)3-5-12(18)24-7-11-13(19)14(20)15(21)16(22)25-11/h2-6,11,13-17,19-22H,7H2,1H3/b5-3+ |
| InChIKey | LVNFIOGAAUPIPC-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CHEBI:168051) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (3,4,5,6-tetrahydroxyoxan-2-yl)methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0125187 | HMDB |