EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O5 |
| Net Charge | 0 |
| Average Mass | 224.212 |
| Monoisotopic Mass | 224.06847 |
| SMILES | Cc1cc(/C=C/C(=O)O)oc1CCC(=O)O |
| InChI | InChI=1S/C11H12O5/c1-7-6-8(2-4-10(12)13)16-9(7)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,12,13)(H,14,15)/b4-2+ |
| InChIKey | XWVYTGBODUKBFE-DUXPYHPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-5-carboxyethyl-2-furanacrylic acid (CHEBI:168027) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 3-[5-[(E)-2-carboxyethenyl]-3-methyluran-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01150052 | LIPID MAPS |