EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O7 |
| Net Charge | 0 |
| Average Mass | 320.297 |
| Monoisotopic Mass | 320.08960 |
| SMILES | COc1c(O)c(OC)c2c(oc3c(OC)c(O)ccc32)c1OC |
| InChI | InChI=1S/C16H16O7/c1-19-12-8(17)6-5-7-9-13(20-2)10(18)15(21-3)16(22-4)14(9)23-11(7)12/h5-6,17-18H,1-4H3 |
| InChIKey | QPJPNKHHNVCLCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Hydroxy-6-methoxy-alpha-pyrufuran (CHEBI:168014) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 1,3,4,6-tetramethoxydibenzouran-2,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 8579144 | ChemSpider |
| HMDB0041295 | HMDB |