EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O11S |
| Net Charge | 0 |
| Average Mass | 416.360 |
| Monoisotopic Mass | 416.04133 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC1CC(C(=O)O)=CC(O)C1OS(=O)(=O)O |
| InChI | InChI=1S/C16H16O11S/c17-10-3-1-8(5-11(10)18)2-4-14(20)26-13-7-9(16(21)22)6-12(19)15(13)27-28(23,24)25/h1-6,12-13,15,17-19H,7H2,(H,21,22)(H,23,24,25)/b4-2+ |
| InChIKey | OSQOSDCSYSIPFY-DUXPYHPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3-hydroxy-4-(sulfooxy)cyclohex-1-ene-1-carboxylic acid (CHEBI:167996) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-hydroxy-4-sulooxycyclohexene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0130155 | HMDB |