EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N3O4 |
| Net Charge | 0 |
| Average Mass | 177.160 |
| Monoisotopic Mass | 177.07496 |
| SMILES | NC(=O)NOCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11N3O4/c6-3(4(9)10)1-2-12-8-5(7)11/h3H,1-2,6H2,(H,9,10)(H3,7,8,11)/t3-/m0/s1 |
| InChIKey | SFYVZOSIAIZWQU-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-Ureidohomoserine (CHEBI:167981) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(carbamoylamino)oxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 168234 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:51767-67-0 | ChemIDplus |