EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O6 |
| Net Charge | 0 |
| Average Mass | 254.238 |
| Monoisotopic Mass | 254.07904 |
| SMILES | COc1cc(O)c(/C=C/C(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C12H14O6/c1-16-9-6-8(13)7(4-5-10(14)15)11(17-2)12(9)18-3/h4-6,13H,1-3H3,(H,14,15)/b5-4+ |
| InChIKey | CMNRNMPLSAEOHD-SNAWJCMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(6-hydroxy-2,3,4-trimethoxyphenyl)prop-2-enoic acid (CHEBI:167970) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(6-hydroxy-2,3,4-trimethoxyphenyl)prop-2-enoic acid |