EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | N[C@H](C(=O)O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO3/c10-7(9(12)13)8(11)6-4-2-1-3-5-6/h1-5,7-8,11H,10H2,(H,12,13)/t7-,8-/m0/s1 |
| InChIKey | VHVGNTVUSQUXPS-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-threo-3-phenylserine (CHEBI:16795) has role metabolite (CHEBI:25212) |
| L-threo-3-phenylserine (CHEBI:16795) is a L-phenylalanine derivative (CHEBI:84144) |
| L-threo-3-phenylserine (CHEBI:16795) is tautomer of L-threo-3-phenylserine zwitterion (CHEBI:57901) |
| Incoming Relation(s) |
| L-threo-3-phenylserine zwitterion (CHEBI:57901) is tautomer of L-threo-3-phenylserine (CHEBI:16795) |
| IUPAC Names |
|---|
| (2S,3S)-2-amino-3-hydroxy-3-phenylpropanoic acid |
| (βS)-β-hydroxy-L-phenylalanine |
| Synonyms | Source |
|---|---|
| L-threo-3-Phenylserine | KEGG COMPOUND |
| L-threo-β-phenylserine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03290 | KEGG COMPOUND |
| HMDB0002184 | HMDB |
| CPD-644 | MetaCyc |
| BB8 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3201138 | Reaxys |
| CAS:6254-48-4 | KEGG COMPOUND |
| Citations |
|---|