EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2O7 |
| Net Charge | 0 |
| Average Mass | 248.191 |
| Monoisotopic Mass | 248.06445 |
| SMILES | NC(CC(=O)NC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12N2O7/c9-3(7(14)15)1-5(11)10-4(8(16)17)2-6(12)13/h3-4H,1-2,9H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | KXAWLANLJYMEGB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-beta-aspartyl-L-aspartic acid (CHEBI:167918) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(3-amino-3-carboxypropanoyl)amino]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 241211 | ChemSpider |
| HMDB0011163 | HMDB |