EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N5O5S |
| Net Charge | 0 |
| Average Mass | 539.658 |
| Monoisotopic Mass | 539.22024 |
| SMILES | CCc1ccccc1NC(=O)CSC(=O)NNC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H33N5O5S/c1-5-17-10-6-8-12-20(17)29-23(33)16-38-26(36)32-31-24(34)22(30-25(35)37-27(2,3)4)14-18-15-28-21-13-9-7-11-19(18)21/h6-13,15,22,28H,5,14,16H2,1-4H3,(H,29,33)(H,30,35)(H,31,34)(H,32,36)/t22-/m0/s1 |
| InChIKey | OTIWAYTTYNFEKL-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Biological Roles: | cathepsin L (EC 3.4.22.15) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor which interferes with the action of cathepsin L (EC 3.4.22.15). antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SID 26681509 (CHEBI:167893) has role antiplasmodial drug (CHEBI:64915) |
| SID 26681509 (CHEBI:167893) has role cathepsin L (EC 3.4.22.15) inhibitor (CHEBI:70821) |
| SID 26681509 (CHEBI:167893) is a tert-butyl ester (CHEBI:140402) |
| SID 26681509 (CHEBI:167893) is a L-tryptophan derivative (CHEBI:47994) |
| SID 26681509 (CHEBI:167893) is a carbohydrazide (CHEBI:35363) |
| SID 26681509 (CHEBI:167893) is a secondary carboxamide (CHEBI:140325) |
| SID 26681509 (CHEBI:167893) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-[2-(2-ethylanilino)-2-oxoethyl] 2-[(2S)-2-[(tert-butoxycarbonyl)amino]-3-(1H-indol-3-yl)propanoyl]hydrazinecarbothioate |
| Synonyms | Source |
|---|---|
| N-[(1,1-dimethylethoxy)carbonyl]-L-tryptophan-2-[[[2-[(2-ethylphenyl)amino]-2-oxoethyl]thio]carbonyl]hydrazide | ChEBI |
| S-[2-(2-ethylanilino)-2-oxoethyl] 2-[(2S)-2-[(tert-butoxycarbonyl)amino]-3-(1H-indol-3-yl)propanoyl]hydrazine-1-carbothioate | IUPAC |
| tert-butyl N-[(2S)-1-[2-[2-(2-ethylanilino)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate | ChEBI |
| SID26681509 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:958772-66-2 | ChEBI |
| Citations |
|---|