EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H6Br5N3 |
| Net Charge | 0 |
| Average Mass | 651.776 |
| Monoisotopic Mass | 646.64786 |
| SMILES | N#Cc1c(-n2c(Br)c(Br)c3cc(Br)ccc32)nc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C17H6Br5N3/c18-7-1-2-13-10(3-7)14(21)16(22)25(13)17-11(6-23)9-4-8(19)5-12(20)15(9)24-17/h1-5,24H |
| InChIKey | JXJDQKCOJBAPQM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aetokthonos hydrillicola (ncbitaxon:1550245) | - | PubMed (33766860) |
| Roles Classification |
|---|
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aetokthonotoxin (CHEBI:167886) has role bacterial metabolite (CHEBI:76969) |
| aetokthonotoxin (CHEBI:167886) has role neurotoxin (CHEBI:50910) |
| aetokthonotoxin (CHEBI:167886) is a biindole alkaloid (CHEBI:167888) |
| aetokthonotoxin (CHEBI:167886) is a bromoindole (CHEBI:52514) |
| aetokthonotoxin (CHEBI:167886) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 2,3,5,5',7'-pentabromo-1'H-[1,2'-biindole]-3'-carbonitrile |
| Synonym | Source |
|---|---|
| AETX | ChEBI |
| UniProt Name | Source |
|---|---|
| aetokthonotoxin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Aetokthonotoxin | Wikipedia |
| Citations |
|---|