EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H6Br5N3 |
| Net Charge | 0 |
| Average Mass | 651.776 |
| Monoisotopic Mass | 646.64786 |
| SMILES | N#Cc1c(-n2c(Br)c(Br)c3cc(Br)ccc32)nc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C17H6Br5N3/c18-7-1-2-13-10(3-7)14(21)16(22)25(13)17-11(6-23)9-4-8(19)5-12(20)15(9)24-17/h1-5,24H |
| InChIKey | JXJDQKCOJBAPQM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aetokthonos hydrillicola (ncbitaxon:1550245) | - | PubMed (33766860) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. neurotoxin A poison that interferes with the functions of the nervous system. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aetokthonotoxin (CHEBI:167886) has role bacterial metabolite (CHEBI:76969) |
| aetokthonotoxin (CHEBI:167886) has role neurotoxin (CHEBI:50910) |
| aetokthonotoxin (CHEBI:167886) is a biindole alkaloid (CHEBI:167888) |
| aetokthonotoxin (CHEBI:167886) is a bromoindole (CHEBI:52514) |
| aetokthonotoxin (CHEBI:167886) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 2,3,5,5',7'-pentabromo-1'H-[1,2'-biindole]-3'-carbonitrile |
| Synonym | Source |
|---|---|
| AETX | ChEBI |
| UniProt Name | Source |
|---|---|
| aetokthonotoxin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Aetokthonotoxin | Wikipedia |
| Citations |
|---|