EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H40N4O7 |
| Net Charge | 0 |
| Average Mass | 628.726 |
| Monoisotopic Mass | 628.28970 |
| SMILES | [H]C(=O)c1nc(Cc2nc3c(c2C)C(=O)[C@H](C(=O)OC)/C3=C2/N=C(C[C@@]3([H])NC(=O)C(C=C)=C3C)[C@@H](C)[C@@H]2CCC(=O)O)c(CC)c1C |
| InChI | InChI=1S/C35H40N4O7/c1-8-19-15(3)26(14-40)36-25(19)13-24-18(6)28-32(38-24)29(30(33(28)43)35(45)46-7)31-21(10-11-27(41)42)17(5)22(37-31)12-23-16(4)20(9-2)34(44)39-23/h9,14,17,21,23,30,36,38H,2,8,10-13H2,1,3-7H3,(H,39,44)(H,41,42)/b31-29-/t17-,21-,23+,30+/m0/s1 |
| InChIKey | ULSSSZOYSMVFIJ-GKGIILGWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-primary fluorescent chlorophyll catabolite (CHEBI:167883) is a primary fluorescent chlorophyll catabolite (CHEBI:47951) |
| Synonym | Source |
|---|---|
| (1R)-pFCC | SUBMITTER |