EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8NO2 |
| Net Charge | -1 |
| Average Mass | 162.168 |
| Monoisotopic Mass | 162.05605 |
| SMILES | O=C([O-])C1Cc2ccccc2N1 |
| InChI | InChI=1S/C9H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-4,8,10H,5H2,(H,11,12)/p-1 |
| InChIKey | QNRXNRGSOJZINA-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | HAP-1 (BTO:0003618) | MetaboLights (MTBLS2205) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indoline-2-carboxylate (CHEBI:167877) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2,3-dihydro-1H-indole-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 11427542 | ChemSpider |