EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | O=C(O)C(=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C9H8O4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,7,10H,(H,12,13) |
| InChIKey | ZHLWCBHWYUISFY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | HAP-1 (BTO:0003618) | MetaboLights (MTBLS2205) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxyphenylpyruvic acid (CHEBI:167876) has functional parent pyruvic acid (CHEBI:32816) |
| Hydroxyphenylpyruvic acid (CHEBI:167876) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| IUPAC Name |
|---|
| 3-hydroxy-2-oxo-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 11596439 | ChemSpider |