EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | COc1ccc([C@@H]2COc3cc(O)ccc3C2=O)c(O)c1 |
| InChI | InChI=1S/C16H14O5/c1-20-10-3-5-11(14(18)7-10)13-8-21-15-6-9(17)2-4-12(15)16(13)19/h2-7,13,17-18H,8H2,1H3/t13-/m0/s1 |
| InChIKey | WQCJOKYOIJVEFN-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vestitone (CHEBI:16786) has role antibacterial agent (CHEBI:33282) |
| vestitone (CHEBI:16786) has role metabolite (CHEBI:25212) |
| vestitone (CHEBI:16786) is a (3R)-2'-hydroxyisoflavanones (CHEBI:140183) |
| vestitone (CHEBI:16786) is a hydroxyisoflavanone (CHEBI:72739) |
| vestitone (CHEBI:16786) is a methoxyisoflavanone (CHEBI:72740) |
| IUPAC Name |
|---|
| (3R)-7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Vestitone | KEGG COMPOUND |
| 2,3-Dihydro-7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| 7,2'-Dihydroxy-4'-methoxyisoflavanone | ChEBI |
| (3R)-vestitol | ChEBI |
| Vestitone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (3R)-vestitone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00786 | KEGG COMPOUND |
| VESTITONE | MetaCyc |
| LMPK12050462 | LIPID MAPS |
| HMDB0031620 | HMDB |
| C00002584 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19983204 | Reaxys |
| CAS:66211-83-4 | KEGG COMPOUND |
| CAS:66211-83-4 | ChemIDplus |
| CAS:158112-50-6 | KEGG COMPOUND |
| Citations |
|---|