EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | COc1ccc([C@@H]2COc3cc(O)ccc3C2=O)c(O)c1 |
| InChI | InChI=1S/C16H14O5/c1-20-10-3-5-11(14(18)7-10)13-8-21-15-6-9(17)2-4-12(15)16(13)19/h2-7,13,17-18H,8H2,1H3/t13-/m0/s1 |
| InChIKey | WQCJOKYOIJVEFN-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vestitone (CHEBI:16786) has role antibacterial agent (CHEBI:33282) |
| vestitone (CHEBI:16786) has role metabolite (CHEBI:25212) |
| vestitone (CHEBI:16786) is a (3R)-2'-hydroxyisoflavanones (CHEBI:140183) |
| vestitone (CHEBI:16786) is a hydroxyisoflavanone (CHEBI:72739) |
| vestitone (CHEBI:16786) is a methoxyisoflavanone (CHEBI:72740) |
| IUPAC Name |
|---|
| (3R)-7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2,3-Dihydro-7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| (3R)-vestitol | ChEBI |
| 7,2'-Dihydroxy-4'-methoxyisoflavanone | ChEBI |
| Vestitone | KEGG COMPOUND |
| Vestitone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (3R)-vestitone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002584 | KNApSAcK |
| C00786 | KEGG COMPOUND |
| HMDB0031620 | HMDB |
| LMPK12050462 | LIPID MAPS |
| VESTITONE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19983204 | Reaxys |
| CAS:158112-50-6 | KEGG COMPOUND |
| CAS:66211-83-4 | KEGG COMPOUND |
| CAS:66211-83-4 | ChemIDplus |
| Citations |
|---|